C28H21N3O7S — CID 18905245
2-hydroxy-5-[[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid (PubChem CID 18905245) has the molecular formula C28H21N3O7S and a molecular weight of 543.56 g/mol. Its IUPAC name is 2-hydroxy-5-[[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid.
| Compound Name | 2-hydroxy-5-[[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 18905245 |
| Molecular Formula | C28H21N3O7S |
| Molecular Weight | 543.56 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 2-hydroxy-5-[[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2ccc(O)c(C(=O)O)c2)c2ccccc2)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H21N3O7S/c32-24-13-12-20(16-23(24)28(35)36)30-27(34)25(17-6-2-1-3-7-17)39-22-11-5-9-19(15-22)29-26(33)18-8-4-10-21(14-18)31(37)38/h1-16,25,32H,(H,29,33)(H,30,34)(H,35,36) |
| InChIKey | DULQNGDJORMMGP-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 158.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.56 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|