C26H20N2O5S2 — CID 18906397
2-hydroxy-5-[[2-phenyl-2-[3-(thiophene-2-carbonylamino)phenyl]sulfanylacetyl]amino]benzoic acid (PubChem CID 18906397) has the molecular formula C26H20N2O5S2 and a molecular weight of 504.59 g/mol. Its IUPAC name is 2-hydroxy-5-[[2-phenyl-2-[3-(thiophene-2-carbonylamino)phenyl]sulfanylacetyl]amino]benzoic acid.
| Compound Name | 2-hydroxy-5-[[2-phenyl-2-[3-(thiophene-2-carbonylamino)phenyl]sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 18906397 |
| Molecular Formula | C26H20N2O5S2 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | 2-hydroxy-5-[[2-phenyl-2-[3-(thiophene-2-carbonylamino)phenyl]sulfanylacetyl]amino]benzoic acid |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2ccc(O)c(C(=O)O)c2)c2ccccc2)c1)c1cccs1 |
| InChI | InChI=1S/C26H20N2O5S2/c29-21-12-11-18(15-20(21)26(32)33)28-25(31)23(16-6-2-1-3-7-16)35-19-9-4-8-17(14-19)27-24(30)22-10-5-13-34-22/h1-15,23,29H,(H,27,30)(H,28,31)(H,32,33) |
| InChIKey | WNSSMCDFNBJKEK-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|