C29H18Cl4N2O7S — CID 18896113
2-[[3-[2-(3-carboxy-4-hydroxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid (PubChem CID 18896113) has the molecular formula C29H18Cl4N2O7S and a molecular weight of 680.35 g/mol. Its IUPAC name is 2-[[3-[2-(3-carboxy-4-hydroxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid.
| Compound Name | 2-[[3-[2-(3-carboxy-4-hydroxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
|---|---|
| PubChem CID | 18896113 |
| Molecular Formula | C29H18Cl4N2O7S |
| Molecular Weight | 680.35 g/mol |
| Exact Mass | 677.96 |
| IUPAC Name | 2-[[3-[2-(3-carboxy-4-hydroxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
| SMILES | O=C(O)c1cc(NC(=O)C(Sc2cccc(NC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C(=O)O)c2)c2ccccc2)ccc1O |
| InChI | InChI=1S/C29H18Cl4N2O7S/c30-21-19(20(29(41)42)22(31)24(33)23(21)32)26(37)34-14-7-4-8-16(11-14)43-25(13-5-2-1-3-6-13)27(38)35-15-9-10-18(36)17(12-15)28(39)40/h1-12,25,36H,(H,34,37)(H,35,38)(H,39,40)(H,41,42) |
| InChIKey | QYXFCHLUVAWDIU-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.35 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|