C28H18Cl4N2O4S — CID 18896046
2-[[3-(2-anilino-2-oxo-1-phenylethyl)sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid (PubChem CID 18896046) has the molecular formula C28H18Cl4N2O4S and a molecular weight of 620.34 g/mol. Its IUPAC name is 2-[[3-(2-anilino-2-oxo-1-phenylethyl)sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid.
| Compound Name | 2-[[3-(2-anilino-2-oxo-1-phenylethyl)sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
|---|---|
| PubChem CID | 18896046 |
| Molecular Formula | C28H18Cl4N2O4S |
| Molecular Weight | 620.34 g/mol |
| Exact Mass | 617.97 |
| IUPAC Name | 2-[[3-(2-anilino-2-oxo-1-phenylethyl)sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
| SMILES | O=C(O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)Nc1cccc(SC(C(=O)Nc2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C28H18Cl4N2O4S/c29-21-19(20(28(37)38)22(30)24(32)23(21)31)26(35)34-17-12-7-13-18(14-17)39-25(15-8-3-1-4-9-15)27(36)33-16-10-5-2-6-11-16/h1-14,25H,(H,33,36)(H,34,35)(H,37,38) |
| InChIKey | OBQCMKAFEOEBTF-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.34 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|