C29H17Cl4N3O4S3 — CID 18895175
2,3,4,5-tetrachloro-6-[[3-[2-oxo-1-phenyl-2-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]ethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18895175) has the molecular formula C29H17Cl4N3O4S3 and a molecular weight of 709.48 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[3-[2-oxo-1-phenyl-2-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]ethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[3-[2-oxo-1-phenyl-2-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]ethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18895175 |
| Molecular Formula | C29H17Cl4N3O4S3 |
| Molecular Weight | 709.48 g/mol |
| Exact Mass | 706.91 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[3-[2-oxo-1-phenyl-2-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]ethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)Nc1cccc(SC(C(=O)Nc2nc(-c3cccs3)cs2)c2ccccc2)c1 |
| InChI | InChI=1S/C29H17Cl4N3O4S3/c30-21-19(20(28(39)40)22(31)24(33)23(21)32)26(37)34-15-8-4-9-16(12-15)43-25(14-6-2-1-3-7-14)27(38)36-29-35-17(13-42-29)18-10-5-11-41-18/h1-13,25H,(H,34,37)(H,39,40)(H,35,36,38) |
| InChIKey | BEOJFQYEXSFPSW-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.48 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|