C28H17Cl4IN2O4S — CID 18896092
2,3,4,5-tetrachloro-6-[[3-[2-(4-iodoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18896092) has the molecular formula C28H17Cl4IN2O4S and a molecular weight of 746.24 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[3-[2-(4-iodoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[3-[2-(4-iodoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18896092 |
| Molecular Formula | C28H17Cl4IN2O4S |
| Molecular Weight | 746.24 g/mol |
| Exact Mass | 743.87 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[3-[2-(4-iodoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)Nc1cccc(SC(C(=O)Nc2ccc(I)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C28H17Cl4IN2O4S/c29-21-19(20(28(38)39)22(30)24(32)23(21)31)26(36)35-17-7-4-8-18(13-17)40-25(14-5-2-1-3-6-14)27(37)34-16-11-9-15(33)10-12-16/h1-13,25H,(H,34,37)(H,35,36)(H,38,39) |
| InChIKey | XHLOIIPONLKMPL-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.24 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|