C29H20Cl4N2O5S — CID 22785582
2,3,4,5-tetrachloro-6-[[4-[2-(3-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 22785582) has the molecular formula C29H20Cl4N2O5S and a molecular weight of 650.37 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[4-[2-(3-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[4-[2-(3-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 22785582 |
| Molecular Formula | C29H20Cl4N2O5S |
| Molecular Weight | 650.37 g/mol |
| Exact Mass | 647.98 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[4-[2-(3-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | COc1cccc(NC(=O)C(Sc2ccc(NC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C(=O)O)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C29H20Cl4N2O5S/c1-40-18-9-5-8-17(14-18)35-28(37)26(15-6-3-2-4-7-15)41-19-12-10-16(11-13-19)34-27(36)20-21(29(38)39)23(31)25(33)24(32)22(20)30/h2-14,26H,1H3,(H,34,36)(H,35,37)(H,38,39) |
| InChIKey | GVUWQDMNIGLOQP-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.37 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|