C30H20Cl4N2O6S — CID 18896093
2,3,4,5-tetrachloro-6-[[3-[2-(2-methoxycarbonylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18896093) has the molecular formula C30H20Cl4N2O6S and a molecular weight of 678.38 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[3-[2-(2-methoxycarbonylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[3-[2-(2-methoxycarbonylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18896093 |
| Molecular Formula | C30H20Cl4N2O6S |
| Molecular Weight | 678.38 g/mol |
| Exact Mass | 675.98 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[3-[2-(2-methoxycarbonylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | COC(=O)c1ccccc1NC(=O)C(Sc1cccc(NC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)c1)c1ccccc1 |
| InChI | InChI=1S/C30H20Cl4N2O6S/c1-42-30(41)18-12-5-6-13-19(18)36-28(38)26(15-8-3-2-4-9-15)43-17-11-7-10-16(14-17)35-27(37)20-21(29(39)40)23(32)25(34)24(33)22(20)31/h2-14,26H,1H3,(H,35,37)(H,36,38)(H,39,40) |
| InChIKey | QSHBBAKBLFWYCW-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.38 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|