C25H20Cl4N2O5S — CID 18896014
2,3,4,5-tetrachloro-6-[[3-[1-(2-methoxyanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18896014) has the molecular formula C25H20Cl4N2O5S and a molecular weight of 602.32 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[3-[1-(2-methoxyanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[3-[1-(2-methoxyanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18896014 |
| Molecular Formula | C25H20Cl4N2O5S |
| Molecular Weight | 602.32 g/mol |
| Exact Mass | 599.98 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[3-[1-(2-methoxyanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)c1)C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C25H20Cl4N2O5S/c1-3-16(23(32)31-14-9-4-5-10-15(14)36-2)37-13-8-6-7-12(11-13)30-24(33)17-18(25(34)35)20(27)22(29)21(28)19(17)26/h4-11,16H,3H2,1-2H3,(H,30,33)(H,31,32)(H,34,35) |
| InChIKey | ZIJIQDYTZSRABI-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.32 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|