C26H22Cl4N2O4S — CID 18895993
2,3,4,5-tetrachloro-6-[[3-[1-(2,4-dimethylanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18895993) has the molecular formula C26H22Cl4N2O4S and a molecular weight of 600.35 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[3-[1-(2,4-dimethylanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[3-[1-(2,4-dimethylanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18895993 |
| Molecular Formula | C26H22Cl4N2O4S |
| Molecular Weight | 600.35 g/mol |
| Exact Mass | 598.01 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[3-[1-(2,4-dimethylanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)c1)C(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C26H22Cl4N2O4S/c1-4-17(24(33)32-16-9-8-12(2)10-13(16)3)37-15-7-5-6-14(11-15)31-25(34)18-19(26(35)36)21(28)23(30)22(29)20(18)27/h5-11,17H,4H2,1-3H3,(H,31,34)(H,32,33)(H,35,36) |
| InChIKey | CPTROTCYZFCEFP-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.35 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|