C25H19Cl4N3O5S — CID 18896038
2-[[3-[1-(4-carbamoylanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid (PubChem CID 18896038) has the molecular formula C25H19Cl4N3O5S and a molecular weight of 615.32 g/mol. Its IUPAC name is 2-[[3-[1-(4-carbamoylanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid.
| Compound Name | 2-[[3-[1-(4-carbamoylanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
|---|---|
| PubChem CID | 18896038 |
| Molecular Formula | C25H19Cl4N3O5S |
| Molecular Weight | 615.32 g/mol |
| Exact Mass | 612.98 |
| IUPAC Name | 2-[[3-[1-(4-carbamoylanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)c1)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C25H19Cl4N3O5S/c1-2-15(23(34)31-12-8-6-11(7-9-12)22(30)33)38-14-5-3-4-13(10-14)32-24(35)16-17(25(36)37)19(27)21(29)20(28)18(16)26/h3-10,15H,2H2,1H3,(H2,30,33)(H,31,34)(H,32,35)(H,36,37) |
| InChIKey | OYWOQBRTYOEVFV-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.32 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|