C23H15Cl5N2O4S — CID 18895837
2,3,4,5-tetrachloro-6-[[3-[1-(3-chloroanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18895837) has the molecular formula C23H15Cl5N2O4S and a molecular weight of 592.72 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[3-[1-(3-chloroanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[3-[1-(3-chloroanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18895837 |
| Molecular Formula | C23H15Cl5N2O4S |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 589.92 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[3-[1-(3-chloroanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CC(Sc1cccc(NC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)c1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H15Cl5N2O4S/c1-10(21(31)29-12-5-2-4-11(24)8-12)35-14-7-3-6-13(9-14)30-22(32)15-16(23(33)34)18(26)20(28)19(27)17(15)25/h2-10H,1H3,(H,29,31)(H,30,32)(H,33,34) |
| InChIKey | ZGNOYIFGABNIFA-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|