C24H17Cl4FN2O4S — CID 18896019
2,3,4,5-tetrachloro-6-[[3-[1-(4-fluoroanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18896019) has the molecular formula C24H17Cl4FN2O4S and a molecular weight of 590.29 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[3-[1-(4-fluoroanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[3-[1-(4-fluoroanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18896019 |
| Molecular Formula | C24H17Cl4FN2O4S |
| Molecular Weight | 590.29 g/mol |
| Exact Mass | 587.96 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[3-[1-(4-fluoroanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)c1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H17Cl4FN2O4S/c1-2-15(22(32)30-12-8-6-11(29)7-9-12)36-14-5-3-4-13(10-14)31-23(33)16-17(24(34)35)19(26)21(28)20(27)18(16)25/h3-10,15H,2H2,1H3,(H,30,32)(H,31,33)(H,34,35) |
| InChIKey | QEYDVZCFEDEGFR-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.29 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|