C22H20FN3O2S — CID 18913102
4-fluoro-N-[3-[1-oxo-1-(pyridin-4-ylamino)butan-2-yl]sulfanylphenyl]benzamide (PubChem CID 18913102) has the molecular formula C22H20FN3O2S and a molecular weight of 409.49 g/mol. Its IUPAC name is 4-fluoro-N-[3-[1-oxo-1-(pyridin-4-ylamino)butan-2-yl]sulfanylphenyl]benzamide.
| Compound Name | 4-fluoro-N-[3-[1-oxo-1-(pyridin-4-ylamino)butan-2-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18913102 |
| Molecular Formula | C22H20FN3O2S |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 4-fluoro-N-[3-[1-oxo-1-(pyridin-4-ylamino)butan-2-yl]sulfanylphenyl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)c2ccc(F)cc2)c1)C(=O)Nc1ccncc1 |
| InChI | InChI=1S/C22H20FN3O2S/c1-2-20(22(28)25-17-10-12-24-13-11-17)29-19-5-3-4-18(14-19)26-21(27)15-6-8-16(23)9-7-15/h3-14,20H,2H2,1H3,(H,26,27)(H,24,25,28) |
| InChIKey | MORXMLLUFOLYBV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |