C27H28N2O4S — CID 18907153
ethyl 4-[2-[3-[(4-methylbenzoyl)amino]phenyl]sulfanylbutanoylamino]benzoate (PubChem CID 18907153) has the molecular formula C27H28N2O4S and a molecular weight of 476.60 g/mol. Its IUPAC name is ethyl 4-[2-[3-[(4-methylbenzoyl)amino]phenyl]sulfanylbutanoylamino]benzoate.
| Compound Name | ethyl 4-[2-[3-[(4-methylbenzoyl)amino]phenyl]sulfanylbutanoylamino]benzoate |
|---|---|
| PubChem CID | 18907153 |
| Molecular Formula | C27H28N2O4S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | ethyl 4-[2-[3-[(4-methylbenzoyl)amino]phenyl]sulfanylbutanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(CC)Sc2cccc(NC(=O)c3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C27H28N2O4S/c1-4-24(26(31)28-21-15-13-20(14-16-21)27(32)33-5-2)34-23-8-6-7-22(17-23)29-25(30)19-11-9-18(3)10-12-19/h6-17,24H,4-5H2,1-3H3,(H,28,31)(H,29,30) |
| InChIKey | KMDNGKGCBUVPSR-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |