C32H31N3O2S — CID 19299003
N-[3-[1-[(9-ethylcarbazol-3-yl)amino]-1-oxobutan-2-yl]sulfanylphenyl]-4-methylbenzamide (PubChem CID 19299003) has the molecular formula C32H31N3O2S and a molecular weight of 521.69 g/mol. Its IUPAC name is N-[3-[1-[(9-ethylcarbazol-3-yl)amino]-1-oxobutan-2-yl]sulfanylphenyl]-4-methylbenzamide.
| Compound Name | N-[3-[1-[(9-ethylcarbazol-3-yl)amino]-1-oxobutan-2-yl]sulfanylphenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 19299003 |
| Molecular Formula | C32H31N3O2S |
| Molecular Weight | 521.69 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | N-[3-[1-[(9-ethylcarbazol-3-yl)amino]-1-oxobutan-2-yl]sulfanylphenyl]-4-methylbenzamide |
| SMILES | CCC(Sc1cccc(NC(=O)c2ccc(C)cc2)c1)C(=O)Nc1ccc2c(c1)c1ccccc1n2CC |
| InChI | InChI=1S/C32H31N3O2S/c1-4-30(38-25-10-8-9-23(19-25)33-31(36)22-15-13-21(3)14-16-22)32(37)34-24-17-18-29-27(20-24)26-11-6-7-12-28(26)35(29)5-2/h6-20,30H,4-5H2,1-3H3,(H,33,36)(H,34,37) |
| InChIKey | GUVLOERCVPPOLR-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.69 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |