C41H38N4O3S — CID 19321079
N-[(E)-3-[3-[1-[(9-ethylcarbazol-3-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19321079) has the molecular formula C41H38N4O3S and a molecular weight of 666.85 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-[(9-ethylcarbazol-3-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-[(9-ethylcarbazol-3-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19321079 |
| Molecular Formula | C41H38N4O3S |
| Molecular Weight | 666.85 g/mol |
| Exact Mass | 666.27 |
| IUPAC Name | N-[(E)-3-[3-[1-[(9-ethylcarbazol-3-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2cccc(C)c2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc2c(c1)c1ccccc1n2CC |
| InChI | InChI=1S/C41H38N4O3S/c1-4-38(41(48)43-31-21-22-37-34(26-31)33-19-9-10-20-36(33)45(37)5-2)49-32-18-12-17-30(25-32)42-40(47)35(24-28-14-11-13-27(3)23-28)44-39(46)29-15-7-6-8-16-29/h6-26,38H,4-5H2,1-3H3,(H,42,47)(H,43,48)(H,44,46)/b35-24+ |
| InChIKey | UGRZMUTVVSTIOR-JWHWKPFMSA-N |
| XLogP | 9.04 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.85 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|