C42H34N4O3S2 — CID 19320737
N-[(Z)-3-[3-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide (PubChem CID 19320737) has the molecular formula C42H34N4O3S2 and a molecular weight of 706.89 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19320737 |
| Molecular Formula | C42H34N4O3S2 |
| Molecular Weight | 706.89 g/mol |
| Exact Mass | 706.21 |
| IUPAC Name | N-[(Z)-3-[3-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)C(Sc3cccc(NC(=O)/C(=C/c4ccsc4)NC(=O)c4ccccc4)c3)c3ccccc3)ccc21 |
| InChI | InChI=1S/C42H34N4O3S2/c1-2-46-37-19-10-9-18-34(37)35-26-32(20-21-38(35)46)44-42(49)39(29-12-5-3-6-13-29)51-33-17-11-16-31(25-33)43-41(48)36(24-28-22-23-50-27-28)45-40(47)30-14-7-4-8-15-30/h3-27,39H,2H2,1H3,(H,43,48)(H,44,49)(H,45,47)/b36-24- |
| InChIKey | PKHUPYREMKVRFG-IBTHDSTKSA-N |
| XLogP | 9.76 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.89 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|