C36H30N4O4S2 — CID 22188914
N-[(Z)-3-[4-[2-(4-acetamidoanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide (PubChem CID 22188914) has the molecular formula C36H30N4O4S2 and a molecular weight of 646.79 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(4-acetamidoanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(4-acetamidoanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22188914 |
| Molecular Formula | C36H30N4O4S2 |
| Molecular Weight | 646.79 g/mol |
| Exact Mass | 646.17 |
| IUPAC Name | N-[(Z)-3-[4-[2-(4-acetamidoanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C(Sc2ccc(NC(=O)/C(=C/c3ccsc3)NC(=O)c3ccccc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H30N4O4S2/c1-24(41)37-28-12-14-29(15-13-28)39-36(44)33(26-8-4-2-5-9-26)46-31-18-16-30(17-19-31)38-35(43)32(22-25-20-21-45-23-25)40-34(42)27-10-6-3-7-11-27/h2-23,33H,1H3,(H,37,41)(H,38,43)(H,39,44)(H,40,42)/b32-22- |
| InChIKey | LGVWVLFTHJTOPD-JDCMOKTRSA-N |
| XLogP | 7.59 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.79 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|