C36H31N3O5S2 — CID 22188891
N-[(Z)-3-[4-[2-(2,5-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide (PubChem CID 22188891) has the molecular formula C36H31N3O5S2 and a molecular weight of 649.79 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(2,5-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(2,5-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22188891 |
| Molecular Formula | C36H31N3O5S2 |
| Molecular Weight | 649.79 g/mol |
| Exact Mass | 649.17 |
| IUPAC Name | N-[(Z)-3-[4-[2-(2,5-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(OC)c(NC(=O)C(Sc2ccc(NC(=O)/C(=C/c3ccsc3)NC(=O)c3ccccc3)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C36H31N3O5S2/c1-43-28-15-18-32(44-2)30(22-28)38-36(42)33(25-9-5-3-6-10-25)46-29-16-13-27(14-17-29)37-35(41)31(21-24-19-20-45-23-24)39-34(40)26-11-7-4-8-12-26/h3-23,33H,1-2H3,(H,37,41)(H,38,42)(H,39,40)/b31-21- |
| InChIKey | RNPUGHIFUPPOAX-YQYKVWLJSA-N |
| XLogP | 7.65 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.79 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|