C30H25Cl2N3O3S2 — CID 19312091
N-[(Z)-3-[3-[1-(3,4-dichloroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide (PubChem CID 19312091) has the molecular formula C30H25Cl2N3O3S2 and a molecular weight of 610.59 g/mol. Its IUPAC name is N-[(Z)-3-[3-[1-(3,4-dichloroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[1-(3,4-dichloroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19312091 |
| Molecular Formula | C30H25Cl2N3O3S2 |
| Molecular Weight | 610.59 g/mol |
| Exact Mass | 609.07 |
| IUPAC Name | N-[(Z)-3-[3-[1-(3,4-dichloroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2ccsc2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C30H25Cl2N3O3S2/c1-2-27(30(38)34-22-11-12-24(31)25(32)17-22)40-23-10-6-9-21(16-23)33-29(37)26(15-19-13-14-39-18-19)35-28(36)20-7-4-3-5-8-20/h3-18,27H,2H2,1H3,(H,33,37)(H,34,38)(H,35,36)/b26-15- |
| InChIKey | DXZLHWSAZODZGM-YSMPRRRNSA-N |
| XLogP | 7.97 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.59 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|