C32H26Cl3N3O3S — CID 19305755
N-[(Z)-1-(3-chlorophenyl)-3-[3-[1-(3,4-dichloroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19305755) has the molecular formula C32H26Cl3N3O3S and a molecular weight of 639.00 g/mol. Its IUPAC name is N-[(Z)-1-(3-chlorophenyl)-3-[3-[1-(3,4-dichloroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(3-chlorophenyl)-3-[3-[1-(3,4-dichloroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19305755 |
| Molecular Formula | C32H26Cl3N3O3S |
| Molecular Weight | 639.00 g/mol |
| Exact Mass | 637.08 |
| IUPAC Name | N-[(Z)-1-(3-chlorophenyl)-3-[3-[1-(3,4-dichloroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2cccc(Cl)c2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C32H26Cl3N3O3S/c1-2-29(32(41)37-24-14-15-26(34)27(35)19-24)42-25-13-7-12-23(18-25)36-31(40)28(17-20-8-6-11-22(33)16-20)38-30(39)21-9-4-3-5-10-21/h3-19,29H,2H2,1H3,(H,36,40)(H,37,41)(H,38,39)/b28-17- |
| InChIKey | KXYUBILABULNLY-QRQIAZFYSA-N |
| XLogP | 8.57 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.00 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|