C30H26FN3O3S2 — CID 19312119
N-[(Z)-3-[3-[1-(2-fluoroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide (PubChem CID 19312119) has the molecular formula C30H26FN3O3S2 and a molecular weight of 559.69 g/mol. Its IUPAC name is N-[(Z)-3-[3-[1-(2-fluoroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[1-(2-fluoroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19312119 |
| Molecular Formula | C30H26FN3O3S2 |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | N-[(Z)-3-[3-[1-(2-fluoroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2ccsc2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C30H26FN3O3S2/c1-2-27(30(37)33-25-14-7-6-13-24(25)31)39-23-12-8-11-22(18-23)32-29(36)26(17-20-15-16-38-19-20)34-28(35)21-9-4-3-5-10-21/h3-19,27H,2H2,1H3,(H,32,36)(H,33,37)(H,34,35)/b26-17- |
| InChIKey | BLPQHCGIAJPQST-ONUIUJJFSA-N |
| XLogP | 6.81 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|