C31H28ClN3O4S2 — CID 19312134
N-[(Z)-3-[3-[1-(5-chloro-2-methoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide (PubChem CID 19312134) has the molecular formula C31H28ClN3O4S2 and a molecular weight of 606.17 g/mol. Its IUPAC name is N-[(Z)-3-[3-[1-(5-chloro-2-methoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[1-(5-chloro-2-methoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19312134 |
| Molecular Formula | C31H28ClN3O4S2 |
| Molecular Weight | 606.17 g/mol |
| Exact Mass | 605.12 |
| IUPAC Name | N-[(Z)-3-[3-[1-(5-chloro-2-methoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2ccsc2)NC(=O)c2ccccc2)c1)C(=O)Nc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C31H28ClN3O4S2/c1-3-28(31(38)34-25-17-22(32)12-13-27(25)39-2)41-24-11-7-10-23(18-24)33-30(37)26(16-20-14-15-40-19-20)35-29(36)21-8-5-4-6-9-21/h4-19,28H,3H2,1-2H3,(H,33,37)(H,34,38)(H,35,36)/b26-16- |
| InChIKey | AGGHLJSPUJVRLK-QQXSKIMKSA-N |
| XLogP | 7.33 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.17 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|