C31H28N4O4S2 — CID 19312139
4-[2-[3-[[(Z)-2-benzamido-3-thiophen-3-ylprop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzamide (PubChem CID 19312139) has the molecular formula C31H28N4O4S2 and a molecular weight of 584.72 g/mol. Its IUPAC name is 4-[2-[3-[[(Z)-2-benzamido-3-thiophen-3-ylprop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzamide.
| Compound Name | 4-[2-[3-[[(Z)-2-benzamido-3-thiophen-3-ylprop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzamide |
|---|---|
| PubChem CID | 19312139 |
| Molecular Formula | C31H28N4O4S2 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | 4-[2-[3-[[(Z)-2-benzamido-3-thiophen-3-ylprop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2ccsc2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C31H28N4O4S2/c1-2-27(31(39)33-23-13-11-21(12-14-23)28(32)36)41-25-10-6-9-24(18-25)34-30(38)26(17-20-15-16-40-19-20)35-29(37)22-7-4-3-5-8-22/h3-19,27H,2H2,1H3,(H2,32,36)(H,33,39)(H,34,38)(H,35,37)/b26-17- |
| InChIKey | LQOXPUGBNVHERR-ONUIUJJFSA-N |
| XLogP | 5.77 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|