C31H29N3O4S2 — CID 19311982
N-[(Z)-3-[3-[1-(4-ethoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide (PubChem CID 19311982) has the molecular formula C31H29N3O4S2 and a molecular weight of 571.72 g/mol. Its IUPAC name is N-[(Z)-3-[3-[1-(4-ethoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[1-(4-ethoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19311982 |
| Molecular Formula | C31H29N3O4S2 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | N-[(Z)-3-[3-[1-(4-ethoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccc(NC(=O)C(C)Sc2cccc(NC(=O)/C(=C/c3ccsc3)NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C31H29N3O4S2/c1-3-38-26-14-12-24(13-15-26)32-29(35)21(2)40-27-11-7-10-25(19-27)33-31(37)28(18-22-16-17-39-20-22)34-30(36)23-8-5-4-6-9-23/h4-21H,3H2,1-2H3,(H,32,35)(H,33,37)(H,34,36)/b28-18- |
| InChIKey | FWXRKXSKPKEGHD-VEILYXNESA-N |
| XLogP | 6.68 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|