C33H30ClN3O4S — CID 22187251
N-[(Z)-3-[4-[1-(3-chloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22187251) has the molecular formula C33H30ClN3O4S and a molecular weight of 600.14 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-(3-chloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-(3-chloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22187251 |
| Molecular Formula | C33H30ClN3O4S |
| Molecular Weight | 600.14 g/mol |
| Exact Mass | 599.16 |
| IUPAC Name | N-[(Z)-3-[4-[1-(3-chloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C)C(=O)Nc3cccc(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C33H30ClN3O4S/c1-3-41-28-16-12-23(13-17-28)20-30(37-32(39)24-8-5-4-6-9-24)33(40)35-26-14-18-29(19-15-26)42-22(2)31(38)36-27-11-7-10-25(34)21-27/h4-22H,3H2,1-2H3,(H,35,40)(H,36,38)(H,37,39)/b30-20- |
| InChIKey | CFCZYXOKKZYDOW-COEJQBHMSA-N |
| XLogP | 7.27 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.14 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|