C38H31Cl2N3O4S — CID 22190619
N-[(Z)-3-[4-[1-(2,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 22190619) has the molecular formula C38H31Cl2N3O4S and a molecular weight of 696.66 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-(2,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-(2,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22190619 |
| Molecular Formula | C38H31Cl2N3O4S |
| Molecular Weight | 696.66 g/mol |
| Exact Mass | 695.14 |
| IUPAC Name | N-[(Z)-3-[4-[1-(2,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2ccc(OCc3ccccc3)cc2)NC(=O)c2ccccc2)cc1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C38H31Cl2N3O4S/c1-25(36(44)42-34-23-29(39)14-21-33(34)40)48-32-19-15-30(16-20-32)41-38(46)35(43-37(45)28-10-6-3-7-11-28)22-26-12-17-31(18-13-26)47-24-27-8-4-2-5-9-27/h2-23,25H,24H2,1H3,(H,41,46)(H,42,44)(H,43,45)/b35-22- |
| InChIKey | SQJADBKNGXKVRQ-QHDYCIAZSA-N |
| XLogP | 9.10 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.66 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|