C44H36ClN3O4S — CID 22190756
N-[(Z)-3-[4-[2-(5-chloro-2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 22190756) has the molecular formula C44H36ClN3O4S and a molecular weight of 738.31 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(5-chloro-2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(5-chloro-2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22190756 |
| Molecular Formula | C44H36ClN3O4S |
| Molecular Weight | 738.31 g/mol |
| Exact Mass | 737.21 |
| IUPAC Name | N-[(Z)-3-[4-[2-(5-chloro-2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C(Sc1ccc(NC(=O)/C(=C/c2ccc(OCc3ccccc3)cc2)NC(=O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C44H36ClN3O4S/c1-30-17-20-35(45)28-39(30)47-44(51)41(33-13-7-3-8-14-33)53-38-25-21-36(22-26-38)46-43(50)40(48-42(49)34-15-9-4-10-16-34)27-31-18-23-37(24-19-31)52-29-32-11-5-2-6-12-32/h2-28,41H,29H2,1H3,(H,46,50)(H,47,51)(H,48,49)/b40-27- |
| InChIKey | UNGZKJNUQCQAKZ-DPVRLLIJSA-N |
| XLogP | 10.11 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.31 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|