C44H35N3O6S — CID 22190800
4-[[2-[4-[[(Z)-2-benzamido-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid (PubChem CID 22190800) has the molecular formula C44H35N3O6S and a molecular weight of 733.85 g/mol. Its IUPAC name is 4-[[2-[4-[[(Z)-2-benzamido-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[4-[[(Z)-2-benzamido-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 22190800 |
| Molecular Formula | C44H35N3O6S |
| Molecular Weight | 733.85 g/mol |
| Exact Mass | 733.22 |
| IUPAC Name | 4-[[2-[4-[[(Z)-2-benzamido-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2ccc(C(=O)O)cc2)c2ccccc2)cc1)/C(=C/c1ccc(OCc2ccccc2)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C44H35N3O6S/c48-41(33-14-8-3-9-15-33)47-39(28-30-16-24-37(25-17-30)53-29-31-10-4-1-5-11-31)42(49)45-36-22-26-38(27-23-36)54-40(32-12-6-2-7-13-32)43(50)46-35-20-18-34(19-21-35)44(51)52/h1-28,40H,29H2,(H,45,49)(H,46,50)(H,47,48)(H,51,52)/b39-28- |
| InChIKey | ZGRBUMGMRGOPAF-WGSLGHPRSA-N |
| XLogP | 8.85 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.85 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|