C44H37N3O5S — CID 19314780
N-[(E)-3-[3-[2-(3-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19314780) has the molecular formula C44H37N3O5S and a molecular weight of 719.86 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(3-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(3-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19314780 |
| Molecular Formula | C44H37N3O5S |
| Molecular Weight | 719.86 g/mol |
| Exact Mass | 719.25 |
| IUPAC Name | N-[(E)-3-[3-[2-(3-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(NC(=O)C(Sc2cccc(NC(=O)/C(=C\c3ccc(OCc4ccccc4)cc3)NC(=O)c3ccccc3)c2)c2ccccc2)c1 |
| InChI | InChI=1S/C44H37N3O5S/c1-51-38-21-11-19-35(28-38)46-44(50)41(33-15-7-3-8-16-33)53-39-22-12-20-36(29-39)45-43(49)40(47-42(48)34-17-9-4-10-18-34)27-31-23-25-37(26-24-31)52-30-32-13-5-2-6-14-32/h2-29,41H,30H2,1H3,(H,45,49)(H,46,50)(H,47,48)/b40-27+ |
| InChIKey | FXJQQCLSIBGGPI-WOQJSSNBSA-N |
| XLogP | 9.16 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.86 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|