C46H37N5O5S — CID 19321381
N-[(Z)-3-oxo-3-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]-1-phenylethyl]sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19321381) has the molecular formula C46H37N5O5S and a molecular weight of 771.90 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]-1-phenylethyl]sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]-1-phenylethyl]sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19321381 |
| Molecular Formula | C46H37N5O5S |
| Molecular Weight | 771.90 g/mol |
| Exact Mass | 771.25 |
| IUPAC Name | N-[(Z)-3-oxo-3-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]-1-phenylethyl]sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)NC2=NN(c3ccccc3)C(=O)C2)c2ccccc2)c1)/C(=C/c1ccc(OCc2ccccc2)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C46H37N5O5S/c52-42-30-41(50-51(42)37-21-11-4-12-22-37)49-46(55)43(34-16-7-2-8-17-34)57-39-23-13-20-36(29-39)47-45(54)40(48-44(53)35-18-9-3-10-19-35)28-32-24-26-38(27-25-32)56-31-33-14-5-1-6-15-33/h1-29,43H,30-31H2,(H,47,54)(H,48,53)(H,49,50,55)/b40-28- |
| InChIKey | ZRPUFMKKRBEAEB-VDMDNSBISA-N |
| XLogP | 8.38 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.90 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|