C39H30ClN5O4S — CID 19319221
N-[(Z)-1-(4-chlorophenyl)-3-oxo-3-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19319221) has the molecular formula C39H30ClN5O4S and a molecular weight of 700.22 g/mol. Its IUPAC name is N-[(Z)-1-(4-chlorophenyl)-3-oxo-3-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-chlorophenyl)-3-oxo-3-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19319221 |
| Molecular Formula | C39H30ClN5O4S |
| Molecular Weight | 700.22 g/mol |
| Exact Mass | 699.17 |
| IUPAC Name | N-[(Z)-1-(4-chlorophenyl)-3-oxo-3-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]-1-phenylethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)NC2=NN(c3ccccc3)C(=O)C2)c2ccccc2)c1)/C(=C/c1ccc(Cl)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C39H30ClN5O4S/c40-29-21-19-26(20-22-29)23-33(42-37(47)28-13-6-2-7-14-28)38(48)41-30-15-10-18-32(24-30)50-36(27-11-4-1-5-12-27)39(49)43-34-25-35(46)45(44-34)31-16-8-3-9-17-31/h1-24,36H,25H2,(H,41,48)(H,42,47)(H,43,44,49)/b33-23- |
| InChIKey | CZVRDLHLHQFOCU-SNCSUOKWSA-N |
| XLogP | 7.45 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.22 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|