C36H34N6O4S — CID 19319815
N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19319815) has the molecular formula C36H34N6O4S and a molecular weight of 646.77 g/mol. Its IUPAC name is N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19319815 |
| Molecular Formula | C36H34N6O4S |
| Molecular Weight | 646.77 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1cccc(NC(=O)/C(=C\c2ccc(N(C)C)cc2)NC(=O)c2ccccc2)c1)C(=O)NC1=NN(c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C36H34N6O4S/c1-24(34(44)39-32-23-33(43)42(40-32)29-14-8-5-9-15-29)47-30-16-10-13-27(22-30)37-36(46)31(38-35(45)26-11-6-4-7-12-26)21-25-17-19-28(20-18-25)41(2)3/h4-22,24H,23H2,1-3H3,(H,37,46)(H,38,45)(H,39,40,44)/b31-21+ |
| InChIKey | QBZSVMLWYSYMJC-NJZRLIGZSA-N |
| XLogP | 5.51 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.77 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|