C33H30Cl2N4O3S — CID 19308490
N-[(E)-3-[3-[1-(2,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19308490) has the molecular formula C33H30Cl2N4O3S and a molecular weight of 633.60 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(2,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(2,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19308490 |
| Molecular Formula | C33H30Cl2N4O3S |
| Molecular Weight | 633.60 g/mol |
| Exact Mass | 632.14 |
| IUPAC Name | N-[(E)-3-[3-[1-(2,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1cccc(NC(=O)/C(=C\c2ccc(N(C)C)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C33H30Cl2N4O3S/c1-21(31(40)37-29-19-24(34)14-17-28(29)35)43-27-11-7-10-25(20-27)36-33(42)30(38-32(41)23-8-5-4-6-9-23)18-22-12-15-26(16-13-22)39(2)3/h4-21H,1-3H3,(H,36,42)(H,37,40)(H,38,41)/b30-18+ |
| InChIKey | ZTUOHQCFHOIZPG-UXHLAJHPSA-N |
| XLogP | 7.59 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.60 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|