C34H33ClN4O3S — CID 19308486
N-[(E)-3-[3-[1-(3-chloro-4-methylanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19308486) has the molecular formula C34H33ClN4O3S and a molecular weight of 613.18 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(3-chloro-4-methylanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(3-chloro-4-methylanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19308486 |
| Molecular Formula | C34H33ClN4O3S |
| Molecular Weight | 613.18 g/mol |
| Exact Mass | 612.20 |
| IUPAC Name | N-[(E)-3-[3-[1-(3-chloro-4-methylanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(NC(=O)C(C)Sc2cccc(NC(=O)/C(=C\c3ccc(N(C)C)cc3)NC(=O)c3ccccc3)c2)cc1Cl |
| InChI | InChI=1S/C34H33ClN4O3S/c1-22-13-16-27(21-30(22)35)36-32(40)23(2)43-29-12-8-11-26(20-29)37-34(42)31(38-33(41)25-9-6-5-7-10-25)19-24-14-17-28(18-15-24)39(3)4/h5-21,23H,1-4H3,(H,36,40)(H,37,42)(H,38,41)/b31-19+ |
| InChIKey | BQPWGYLWRLHYPE-ZCTHSVRISA-N |
| XLogP | 7.24 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.18 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|