C35H36N4O3S — CID 21386265
N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[4-[1-(2,6-dimethylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21386265) has the molecular formula C35H36N4O3S and a molecular weight of 592.77 g/mol. Its IUPAC name is N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[4-[1-(2,6-dimethylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[4-[1-(2,6-dimethylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21386265 |
| Molecular Formula | C35H36N4O3S |
| Molecular Weight | 592.77 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[4-[1-(2,6-dimethylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(C)Sc1ccc(NC(=O)/C(=C/c2ccc(N(C)C)cc2)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H36N4O3S/c1-23-10-9-11-24(2)32(23)38-33(40)25(3)43-30-20-16-28(17-21-30)36-35(42)31(37-34(41)27-12-7-6-8-13-27)22-26-14-18-29(19-15-26)39(4)5/h6-22,25H,1-5H3,(H,36,42)(H,37,41)(H,38,40)/b31-22- |
| InChIKey | QMNXIGUSVYVLEA-VAMRJTSQSA-N |
| XLogP | 6.90 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.77 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|