C35H34N4O5S — CID 21386273
methyl 2-[2-[4-[[(Z)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate (PubChem CID 21386273) has the molecular formula C35H34N4O5S and a molecular weight of 622.75 g/mol. Its IUPAC name is methyl 2-[2-[4-[[(Z)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate.
| Compound Name | methyl 2-[2-[4-[[(Z)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate |
|---|---|
| PubChem CID | 21386273 |
| Molecular Formula | C35H34N4O5S |
| Molecular Weight | 622.75 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | methyl 2-[2-[4-[[(Z)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C(C)Sc1ccc(NC(=O)/C(=C/c2ccc(N(C)C)cc2)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H34N4O5S/c1-23(32(40)37-30-13-9-8-12-29(30)35(43)44-4)45-28-20-16-26(17-21-28)36-34(42)31(38-33(41)25-10-6-5-7-11-25)22-24-14-18-27(19-15-24)39(2)3/h5-23H,1-4H3,(H,36,42)(H,37,40)(H,38,41)/b31-22- |
| InChIKey | TYEDJYWLUDPYLL-VAMRJTSQSA-N |
| XLogP | 6.07 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.75 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|