C34H31N3O5S — CID 19313418
methyl 2-[2-[3-[[(E)-2-benzamido-3-(3-methylphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate (PubChem CID 19313418) has the molecular formula C34H31N3O5S and a molecular weight of 593.71 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(E)-2-benzamido-3-(3-methylphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate.
| Compound Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(3-methylphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate |
|---|---|
| PubChem CID | 19313418 |
| Molecular Formula | C34H31N3O5S |
| Molecular Weight | 593.71 g/mol |
| Exact Mass | 593.20 |
| IUPAC Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(3-methylphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C(C)Sc1cccc(NC(=O)/C(=C\c2cccc(C)c2)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C34H31N3O5S/c1-22-11-9-12-24(19-22)20-30(37-32(39)25-13-5-4-6-14-25)33(40)35-26-15-10-16-27(21-26)43-23(2)31(38)36-29-18-8-7-17-28(29)34(41)42-3/h4-21,23H,1-3H3,(H,35,40)(H,36,38)(H,37,39)/b30-20+ |
| InChIKey | KPVQXODYQZGUMA-TWKHWXDSSA-N |
| XLogP | 6.31 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.71 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|