C33H30ClN3O3S — CID 19305613
N-[(Z)-1-(3-chlorophenyl)-3-[3-[1-(2,3-dimethylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19305613) has the molecular formula C33H30ClN3O3S and a molecular weight of 584.14 g/mol. Its IUPAC name is N-[(Z)-1-(3-chlorophenyl)-3-[3-[1-(2,3-dimethylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(3-chlorophenyl)-3-[3-[1-(2,3-dimethylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19305613 |
| Molecular Formula | C33H30ClN3O3S |
| Molecular Weight | 584.14 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | N-[(Z)-1-(3-chlorophenyl)-3-[3-[1-(2,3-dimethylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1cccc(NC(=O)C(C)Sc2cccc(NC(=O)/C(=C/c3cccc(Cl)c3)NC(=O)c3ccccc3)c2)c1C |
| InChI | InChI=1S/C33H30ClN3O3S/c1-21-10-7-17-29(22(21)2)36-31(38)23(3)41-28-16-9-15-27(20-28)35-33(40)30(19-24-11-8-14-26(34)18-24)37-32(39)25-12-5-4-6-13-25/h4-20,23H,1-3H3,(H,35,40)(H,36,38)(H,37,39)/b30-19- |
| InChIKey | CIKKCBMTJRKWMR-FSGOGVSDSA-N |
| XLogP | 7.49 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.14 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|