C34H30ClN3O5S — CID 19305626
ethyl 4-[2-[3-[[(Z)-2-benzamido-3-(3-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate (PubChem CID 19305626) has the molecular formula C34H30ClN3O5S and a molecular weight of 628.15 g/mol. Its IUPAC name is ethyl 4-[2-[3-[[(Z)-2-benzamido-3-(3-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate.
| Compound Name | ethyl 4-[2-[3-[[(Z)-2-benzamido-3-(3-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate |
|---|---|
| PubChem CID | 19305626 |
| Molecular Formula | C34H30ClN3O5S |
| Molecular Weight | 628.15 g/mol |
| Exact Mass | 627.16 |
| IUPAC Name | ethyl 4-[2-[3-[[(Z)-2-benzamido-3-(3-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(C)Sc2cccc(NC(=O)/C(=C/c3cccc(Cl)c3)NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C34H30ClN3O5S/c1-3-43-34(42)25-15-17-27(18-16-25)36-31(39)22(2)44-29-14-8-13-28(21-29)37-33(41)30(20-23-9-7-12-26(35)19-23)38-32(40)24-10-5-4-6-11-24/h4-22H,3H2,1-2H3,(H,36,39)(H,37,41)(H,38,40)/b30-20- |
| InChIKey | RFKDGEJEPPETGW-COEJQBHMSA-N |
| XLogP | 7.05 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.15 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|