C32H28ClN3O3S — CID 19305909
N-[(Z)-1-(4-chlorophenyl)-3-[3-[1-(4-methylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19305909) has the molecular formula C32H28ClN3O3S and a molecular weight of 570.11 g/mol. Its IUPAC name is N-[(Z)-1-(4-chlorophenyl)-3-[3-[1-(4-methylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-chlorophenyl)-3-[3-[1-(4-methylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19305909 |
| Molecular Formula | C32H28ClN3O3S |
| Molecular Weight | 570.11 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | N-[(Z)-1-(4-chlorophenyl)-3-[3-[1-(4-methylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(NC(=O)C(C)Sc2cccc(NC(=O)/C(=C/c3ccc(Cl)cc3)NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C32H28ClN3O3S/c1-21-11-17-26(18-12-21)34-30(37)22(2)40-28-10-6-9-27(20-28)35-32(39)29(19-23-13-15-25(33)16-14-23)36-31(38)24-7-4-3-5-8-24/h3-20,22H,1-2H3,(H,34,37)(H,35,39)(H,36,38)/b29-19- |
| InChIKey | CGUQKCCKTLLXKP-CEUNXORHSA-N |
| XLogP | 7.18 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.11 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|