C34H34N4O3S — CID 21386250
N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[4-[1-(2-methylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21386250) has the molecular formula C34H34N4O3S and a molecular weight of 578.74 g/mol. Its IUPAC name is N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[4-[1-(2-methylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[4-[1-(2-methylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21386250 |
| Molecular Formula | C34H34N4O3S |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[4-[1-(2-methylanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccccc1NC(=O)C(C)Sc1ccc(NC(=O)/C(=C/c2ccc(N(C)C)cc2)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H34N4O3S/c1-23-10-8-9-13-30(23)36-32(39)24(2)42-29-20-16-27(17-21-29)35-34(41)31(37-33(40)26-11-6-5-7-12-26)22-25-14-18-28(19-15-25)38(3)4/h5-22,24H,1-4H3,(H,35,41)(H,36,39)(H,37,40)/b31-22- |
| InChIKey | GJIYMVLWACJBKG-VAMRJTSQSA-N |
| XLogP | 6.59 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|