C35H36N4O5S — CID 21386262
N-[(Z)-3-[4-[1-(2,4-dimethoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21386262) has the molecular formula C35H36N4O5S and a molecular weight of 624.76 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-(2,4-dimethoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-(2,4-dimethoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21386262 |
| Molecular Formula | C35H36N4O5S |
| Molecular Weight | 624.76 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | N-[(Z)-3-[4-[1-(2,4-dimethoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(NC(=O)C(C)Sc2ccc(NC(=O)/C(=C/c3ccc(N(C)C)cc3)NC(=O)c3ccccc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C35H36N4O5S/c1-23(33(40)37-30-20-17-28(43-4)22-32(30)44-5)45-29-18-13-26(14-19-29)36-35(42)31(38-34(41)25-9-7-6-8-10-25)21-24-11-15-27(16-12-24)39(2)3/h6-23H,1-5H3,(H,36,42)(H,37,40)(H,38,41)/b31-21- |
| InChIKey | PDCRRXBTUHRFFF-YQYKVWLJSA-N |
| XLogP | 6.30 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.76 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|