C39H34N4O5S — CID 22190669
2-[2-[4-[[(Z)-2-benzamido-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzamide (PubChem CID 22190669) has the molecular formula C39H34N4O5S and a molecular weight of 670.79 g/mol. Its IUPAC name is 2-[2-[4-[[(Z)-2-benzamido-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzamide.
| Compound Name | 2-[2-[4-[[(Z)-2-benzamido-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzamide |
|---|---|
| PubChem CID | 22190669 |
| Molecular Formula | C39H34N4O5S |
| Molecular Weight | 670.79 g/mol |
| Exact Mass | 670.22 |
| IUPAC Name | 2-[2-[4-[[(Z)-2-benzamido-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2ccc(OCc3ccccc3)cc2)NC(=O)c2ccccc2)cc1)C(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C39H34N4O5S/c1-26(37(45)42-34-15-9-8-14-33(34)36(40)44)49-32-22-18-30(19-23-32)41-39(47)35(43-38(46)29-12-6-3-7-13-29)24-27-16-20-31(21-17-27)48-25-28-10-4-2-5-11-28/h2-24,26H,25H2,1H3,(H2,40,44)(H,41,47)(H,42,45)(H,43,46)/b35-24- |
| InChIKey | FFFFXBJVAVPTOR-BGDIREAQSA-N |
| XLogP | 6.89 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.79 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|