C44H35N3O4S2 — CID 22784427
N-[(Z)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 22784427) has the molecular formula C44H35N3O4S2 and a molecular weight of 733.92 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22784427 |
| Molecular Formula | C44H35N3O4S2 |
| Molecular Weight | 733.92 g/mol |
| Exact Mass | 733.21 |
| IUPAC Name | N-[(Z)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2ccc(OCc3ccccc3)cc2)NC(=O)c2ccccc2)cc1)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C44H35N3O4S2/c1-30(44(50)47-38-16-8-10-18-40(38)53-41-19-11-9-17-39(41)47)52-36-26-22-34(23-27-36)45-43(49)37(46-42(48)33-14-6-3-7-15-33)28-31-20-24-35(25-21-31)51-29-32-12-4-2-5-13-32/h2-28,30H,29H2,1H3,(H,45,49)(H,46,48)/b37-28- |
| InChIKey | DWNFGHSNEFKDRC-FSUXQIQLSA-N |
| XLogP | 9.99 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.92 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|