C37H28FN3O3S2 — CID 22784127
N-[(Z)-1-(2-fluorophenyl)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 22784127) has the molecular formula C37H28FN3O3S2 and a molecular weight of 645.78 g/mol. Its IUPAC name is N-[(Z)-1-(2-fluorophenyl)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-fluorophenyl)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22784127 |
| Molecular Formula | C37H28FN3O3S2 |
| Molecular Weight | 645.78 g/mol |
| Exact Mass | 645.16 |
| IUPAC Name | N-[(Z)-1-(2-fluorophenyl)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylpropan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2ccccc2F)NC(=O)c2ccccc2)cc1)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C37H28FN3O3S2/c1-24(37(44)41-31-15-7-9-17-33(31)46-34-18-10-8-16-32(34)41)45-28-21-19-27(20-22-28)39-36(43)30(23-26-13-5-6-14-29(26)38)40-35(42)25-11-3-2-4-12-25/h2-24H,1H3,(H,39,43)(H,40,42)/b30-23- |
| InChIKey | NCRYVWQMBSPWPM-WMMMYUQOSA-N |
| XLogP | 8.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.78 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|