C42H33N3O3S2 — CID 22784208
N-[(Z)-1-naphthalen-1-yl-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 22784208) has the molecular formula C42H33N3O3S2 and a molecular weight of 691.88 g/mol. Its IUPAC name is N-[(Z)-1-naphthalen-1-yl-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-naphthalen-1-yl-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22784208 |
| Molecular Formula | C42H33N3O3S2 |
| Molecular Weight | 691.88 g/mol |
| Exact Mass | 691.20 |
| IUPAC Name | N-[(Z)-1-naphthalen-1-yl-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1ccc(NC(=O)/C(=C/c2cccc3ccccc23)NC(=O)c2ccccc2)cc1)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C42H33N3O3S2/c1-2-37(42(48)45-35-19-8-10-21-38(35)50-39-22-11-9-20-36(39)45)49-32-25-23-31(24-26-32)43-41(47)34(44-40(46)29-14-4-3-5-15-29)27-30-17-12-16-28-13-6-7-18-33(28)30/h3-27,37H,2H2,1H3,(H,43,47)(H,44,46)/b34-27- |
| InChIKey | DCDLKGSHRUTEIX-YLHCSOALSA-N |
| XLogP | 9.95 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.88 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|