C40H35N3O5S2 — CID 22783968
N-[(Z)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 22783968) has the molecular formula C40H35N3O5S2 and a molecular weight of 701.87 g/mol. Its IUPAC name is N-[(Z)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22783968 |
| Molecular Formula | C40H35N3O5S2 |
| Molecular Weight | 701.87 g/mol |
| Exact Mass | 701.20 |
| IUPAC Name | N-[(Z)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1ccc(NC(=O)/C(=C/c2cc(OC)ccc2OC)NC(=O)c2ccccc2)cc1)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C40H35N3O5S2/c1-4-35(40(46)43-32-14-8-10-16-36(32)50-37-17-11-9-15-33(37)43)49-30-21-18-28(19-22-30)41-39(45)31(42-38(44)26-12-6-5-7-13-26)25-27-24-29(47-2)20-23-34(27)48-3/h5-25,35H,4H2,1-3H3,(H,41,45)(H,42,44)/b31-25- |
| InChIKey | PLTVPSWAXFNIRB-GDWJVWIDSA-N |
| XLogP | 8.81 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.87 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|