C38H30FN3O3S2 — CID 22784128
N-[(Z)-1-(2-fluorophenyl)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 22784128) has the molecular formula C38H30FN3O3S2 and a molecular weight of 659.81 g/mol. Its IUPAC name is N-[(Z)-1-(2-fluorophenyl)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-fluorophenyl)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22784128 |
| Molecular Formula | C38H30FN3O3S2 |
| Molecular Weight | 659.81 g/mol |
| Exact Mass | 659.17 |
| IUPAC Name | N-[(Z)-1-(2-fluorophenyl)-3-oxo-3-[4-(1-oxo-1-phenothiazin-10-ylbutan-2-yl)sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1ccc(NC(=O)/C(=C/c2ccccc2F)NC(=O)c2ccccc2)cc1)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C38H30FN3O3S2/c1-2-33(38(45)42-31-16-8-10-18-34(31)47-35-19-11-9-17-32(35)42)46-28-22-20-27(21-23-28)40-37(44)30(24-26-14-6-7-15-29(26)39)41-36(43)25-12-4-3-5-13-25/h3-24,33H,2H2,1H3,(H,40,44)(H,41,43)/b30-24- |
| InChIKey | HUEYEUSJMQQHIB-KRUMMXJUSA-N |
| XLogP | 8.94 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.81 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|